|
CAS#: 16875-28-8 Product: (2S)-2-{[(2S)-2-Ammonio-3-Hydroxypropanoyl]Amino}-3-Phenylpropanoate No suppilers available for the product. |
| Name | (2S)-2-{[(2S)-2-Ammonio-3-Hydroxypropanoyl]Amino}-3-Phenylpropanoate |
|---|---|
| Synonyms | (2S)-2-{[ |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 16875-28-8 |
| SMILES | [O-]C(=O)[C@@H](NC(=O)[C@@H]([NH3+])CO)Cc1ccccc1 |
| InChI | 1S/C12H16N2O4/c13-9(7-15)11(16)14-10(12(17)18)6-8-4-2-1-3-5-8/h1-5,9-10,15H,6-7,13H2,(H,14,16)(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | PPQRSMGDOHLTBE-UWVGGRQHSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.593°C at 760 mmHg (Cal.) |
| Flash point | 310.375°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| (1) | I.H. Helle, C.V. Lokken, C.H. Gorbitz, B. Dalhus. l-Seryl-l-phenylalanine, Acta Cryst C 2004 Volume 60 Part 10 Page o771-o772 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-2-{[(2S)-2-Ammonio-3-Hydroxypropanoyl]Amino}-3-Phenylpropanoate |