|
CAS#: 127556-03-0 Product: Dimethyl {2-[(1S,5R,7R)-10,10-Dimethyl-3,3-Dioxido-3-Thia-4-Azatricyclo[5.2.1.01,5]Dec-4-Yl]-2-Oxoethyl}Carbonodithioimidate No suppilers available for the product. |
| Name | Dimethyl {2-[(1S,5R,7R)-10,10-Dimethyl-3,3-Dioxido-3-Thia-4-Azatricyclo[5.2.1.01,5]Dec-4-Yl]-2-Oxoethyl}Carbonodithioimidate |
|---|---|
| Synonyms | (2R)-BORNANE-10,2-SULTAMGLYCINATE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24N2O3S3 |
| Molecular Weight | 376.56 |
| CAS Registry Number | 127556-03-0 |
| SMILES | O=C(N2[C@@H]3C[C@@H]1C([C@]3(CC1)CS2(=O)=O)(C)C)C/N=C(\SC)SC |
| InChI | 1S/C15H24N2O3S3/c1-14(2)10-5-6-15(14)9-23(19,20)17(11(15)7-10)12(18)8-16-13(21-3)22-4/h10-11H,5-9H2,1-4H3/t10-,11-,15-/m1/s1 |
| InChIKey | IXTNNTWFDQGMIN-UEKVPHQBSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.884°C at 760 mmHg (Cal.) |
| Flash point | 256.121°C (Cal.) |
| Refractive index | 1.681 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl {2-[(1S,5R,7R)-10,10-Dimethyl-3,3-Dioxido-3-Thia-4-Azatricyclo[5.2.1.01,5]Dec-4-Yl]-2-Oxoethyl}Carbonodithioimidate |