Online Database of Chemicals from Around the World
| Name | Dimethyl 4-Dimethylaminophthalate |
|---|---|
| Synonyms | 4-Dimethylaminobenzene-1,2-Dicarboxylic Acid Dimethyl Ester; Dimethyl 4-Dimethylaminophthalate |
| Molecular Structure |  |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 |
| CAS Registry Number | 39617-05-5 |
| EINECS | 254-544-0 |
| SMILES | C1=C(N(C)C)C=CC(=C1C(OC)=O)C(OC)=O |
| InChI | 1S/C12H15NO4/c1-13(2)8-5-6-9(11(14)16-3)10(7-8)12(15)17-4/h5-7H,1-4H3 |
| InChIKey | IQMSCTLQIWAFDD-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.68°C at 760 mmHg (Cal.) |
| Flash point | 162.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-Dimethylaminophthalate |
