Online Database of Chemicals from Around the World
|
CAS#: 128038-44-8 Product: 4,8-Dimethoxy-1,5-Naphthalenedicarbaldehyde No suppilers available for the product. |
| Name | 4,8-Dimethoxy-1,5-Naphthalenedicarbaldehyde |
|---|---|
| Synonyms | 1,5-Diformyl-4,8-dimethoxynaphthalene; 4,8-Dimethoxy-naphthalene-1,5-dicarbaldehyde |
| Molecular Structure |  |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.24 |
| CAS Registry Number | 128038-44-8 |
| SMILES | COc1ccc(c2c1c(ccc2OC)C=O)C=O |
| InChI | 1S/C14H12O4/c1-17-11-5-3-10(8-16)14-12(18-2)6-4-9(7-15)13(11)14/h3-8H,1-2H3 |
| InChIKey | HGZBGPCUMDHKMC-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.774°C at 760 mmHg (Cal.) |
| Flash point | 212.236°C (Cal.) |
| Refractive index | 1.649 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Dimethoxy-1,5-Naphthalenedicarbaldehyde |