Online Database of Chemicals from Around the World
| Name | 4-(4,8-Dimethoxynaphthalen-1-Yl)Butanoic Acid |
|---|---|
| Synonyms | 4-(4,8-Dimethoxy-1-Naphthyl)Butanoic Acid; 4-(4,8-Dimethoxy-1-Naphthyl)Butyric Acid; Nsc28076 |
| Molecular Structure |  |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 |
| CAS Registry Number | 25178-78-3 |
| SMILES | C1=C(C2=C(C(=C1)CCCC(O)=O)C(=CC=C2)OC)OC |
| InChI | 1S/C16H18O4/c1-19-13-10-9-11(5-3-8-15(17)18)16-12(13)6-4-7-14(16)20-2/h4,6-7,9-10H,3,5,8H2,1-2H3,(H,17,18) |
| InChIKey | WUNYGHPIWPIADH-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.322°C at 760 mmHg (Cal.) |
| Flash point | 172.429°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4,8-Dimethoxynaphthalen-1-Yl)Butanoic Acid |
