Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8992-5085 | |||
|
sales@amadischem.com | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Name | 4-Chloro-1,3-Diethyl-1H-Pyrazole-5-Carboxylic Acid |
|---|---|
| Synonyms | 1H-Pyrazole-5-carboxylic acid, 4-chloro-1,3-diethyl-; 4-Chlor-1,3-diethyl-1H-pyrazol-5-carbonsäure; 4-chloranyl-2,5-diethyl-pyrazole-3-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 |
| CAS Registry Number | 128537-59-7 |
| SMILES | CCc1c(c(n(n1)CC)C(=O)O)Cl |
| InChI | 1S/C8H11ClN2O2/c1-3-5-6(9)7(8(12)13)11(4-2)10-5/h3-4H2,1-2H3,(H,12,13) |
| InChIKey | MZJBIQPUHZOZQB-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.5±42.0°C at 760 mmHg (Cal.) |
| Flash point | 163.9±27.9°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-1,3-Diethyl-1H-Pyrazole-5-Carboxylic Acid |