|
CAS#: 62310-17-2 Product: 2-Chloro-5-Diethylsulfamoyl-Benzoic Acid No suppilers available for the product. |
| Name | 2-Chloro-5-Diethylsulfamoyl-Benzoic Acid |
|---|---|
| Synonyms | Zinc00246250 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClNO4S |
| Molecular Weight | 290.74 |
| CAS Registry Number | 62310-17-2 |
| SMILES | C1=C([S](=O)(=O)N(CC)CC)C=CC(=C1C([O-])=O)Cl |
| InChI | 1S/C11H14ClNO4S/c1-3-13(4-2)18(16,17)8-5-6-10(12)9(7-8)11(14)15/h5-7H,3-4H2,1-2H3,(H,14,15)/p-1 |
| InChIKey | IWLIXVSPGIDTAZ-UHFFFAOYSA-M |
| Boiling point | 445.767°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 223.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-Diethylsulfamoyl-Benzoic Acid |