| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | Potassium Bis[(Nonafluorobutyl)Sulfonyl]Azanide |
|---|---|
| Synonyms | Potassium Bisnonafluoro-1-butanesulfonimidate |
| Molecular Structure | ![]() |
| Molecular Formula | C8F18KNO4S2 |
| Molecular Weight | 619.29 |
| CAS Registry Number | 129135-87-1 |
| SMILES | [K+].FC(F)(C(F)(F)C(F)(F)C(F)(F)F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C8F18NO4S2.K/c9-1(10,5(17,18)19)3(13,14)7(23,24)32(28,29)27-33(30,31)8(25,26)4(15,16)2(11,12)6(20,21)22;/q-1;+1 |
| InChIKey | XESFGOBWYAMCMB-UHFFFAOYSA-N |
| Boiling point | 274.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 119.5°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Potassium Bis[(Nonafluorobutyl)Sulfonyl]Azanide |