Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[(3-Methyl-2-Butanyl)Sulfanyl]Pyridine 1-Oxide |
|---|---|
| Synonyms | 4-((3-methylbutan-2-yl)thio)pyridine 1-oxide |
| Molecular Structure | ![CAS#: 129598-84-1， 4-[(3-Methyl-2-Butanyl)Sulfanyl]Pyridine 1-Oxide](/moreStructures/129598-84-1.gif) |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 |
| CAS Registry Number | 129598-84-1 |
| SMILES | CC(C)C(C)Sc1cc[n+](cc1)[O-] |
| InChI | 1S/C10H15NOS/c1-8(2)9(3)13-10-4-6-11(12)7-5-10/h4-9H,1-3H3 |
| InChIKey | QYNLUMVVHYEBBB-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.293°C at 760 mmHg (Cal.) |
| Flash point | 171.699°C (Cal.) |
| Refractive index | 1.541 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(3-Methyl-2-Butanyl)Sulfanyl]Pyridine 1-Oxide |