Online Database of Chemicals from Around the World
|
CAS#: 130063-43-3 Product: Dibenzo(a,l)Pyrene 8,9-Dihydrodiol No suppilers available for the product. |
| Name | Dibenzo(a,l)Pyrene 8,9-Dihydrodiol |
|---|---|
| Synonyms | Dibenzo(A,L)Pyrene-8,9-Dihydrodiol; Dibenzo(Def,P)Chrysene-8,9-Diol, 8,9-Dihydro-; 8,9-Dihydrodiol Dibenzo(A,L)Pyrene |
| Molecular Structure |  |
| Molecular Formula | C24H16O2 |
| Molecular Weight | 336.39 |
| CAS Registry Number | 130063-43-3 |
| SMILES | C1=CC=C4C(=C1)C3=C6C(=C2C=CC=C5C2=C3C(=C4)C(C5O)O)C=CC=C6 |
| InChI | 1S/C24H16O2/c25-23-18-11-5-10-17-15-8-3-4-9-16(15)20-14-7-2-1-6-13(14)12-19(24(23)26)22(20)21(17)18/h1-12,23-26H |
| InChIKey | NDCWEARXOFJOPX-UHFFFAOYSA-N |
| Density | 1.455g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.251°C at 760 mmHg (Cal.) |
| Flash point | 305.186°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo(a,l)Pyrene 8,9-Dihydrodiol |