Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibenzo[b,pqr]Perylene |
|---|---|
| Synonyms | Dibenzo(B,Pqr)Perylene |
| Molecular Structure | ![CAS#: 190-95-4， Dibenzo[b,pqr]Perylene](/moreStructures/190-95-4.gif) |
| Molecular Formula | C26H14 |
| Molecular Weight | 326.40 |
| CAS Registry Number | 190-95-4 |
| SMILES | C1=C5C2=C(C=C1)C7=C(C3=C2C4=C(C=C3)C=CC6=C4C5=CC=C6)C=CC=C7 |
| InChI | 1S/C26H14/c1-2-7-18-17(6-1)19-9-4-10-21-20-8-3-5-15-11-12-16-13-14-22(18)26(25(19)21)24(16)23(15)20/h1-14H |
| InChIKey | UJPJAAQMHAHWRM-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.963°C at 760 mmHg (Cal.) |
| Flash point | 298.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo[b,pqr]Perylene |