| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-[(E)-2-Phenylvinyl]Benzonitrile |
|---|---|
| Synonyms | (E)-4-(2-Phenylethenyl)benzonitrile; 4-(2-Phenylethenyl)benzonitrile; 4-[(E)-2-Phenylethenyl]benzonitrile # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.25 |
| CAS Registry Number | 13041-79-7 |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C#N |
| InChI | 1S/C15H11N/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-11H/b7-6+ |
| InChIKey | WQUHPLQCUQJSQW-VOTSOKGWSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.1±22.0°C at 760 mmHg (Cal.) |
| Flash point | 176.8±14.8°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Liangliang Zhu and Yanli Zhao. Cyanostilbene-based intelligent organic optoelectronic materials, J. Mater. Chem. C, 2013, 1, 1059. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-[(E)-2-Phenylvinyl]Benzonitrile |