Online Database of Chemicals from Around the World
|
CAS#: 4091-14-9 Product: N-Phenyl-N-Vinylacetamide No suppilers available for the product. |
| Name | N-Phenyl-N-Vinylacetamide |
|---|---|
| Synonyms | N-Phenyl-N-Vinyl-Acetamide; N-Phenyl-N-Vinylacetamide; N-Ethenyl-N-Phenyl-Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 |
| CAS Registry Number | 4091-14-9 |
| SMILES | C1=C(N(C(C)=O)C=C)C=CC=C1 |
| InChI | 1S/C10H11NO/c1-3-11(9(2)12)10-7-5-4-6-8-10/h3-8H,1H2,2H3 |
| InChIKey | WUIIRPAMGBRKCV-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.516°C at 760 mmHg (Cal.) |
| Flash point | 112.895°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-N-Vinylacetamide |