Online Database of Chemicals from Around the World
|
CAS#: 13098-88-9 Product: Naphthalen-1-Ylmethyl Acetate No suppilers available for the product. |
| Name | Naphthalen-1-Ylmethyl Acetate |
|---|---|
| Synonyms | 1-Naphthylmethyl Acetate; Acetic Acid 1-Naphthylmethyl Ester; Naphthalen-1-Ylmethyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 |
| CAS Registry Number | 13098-88-9 |
| SMILES | C2=CC1=CC=CC=C1C(=C2)COC(=O)C |
| InChI | 1S/C13H12O2/c1-10(14)15-9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8H,9H2,1H3 |
| InChIKey | DLZJIFRRPVEMAK-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.64°C at 760 mmHg (Cal.) |
| Flash point | 143.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthalen-1-Ylmethyl Acetate |