Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(1-Naphthalenylmethyl)-Acetamide |
|---|---|
| Synonyms | N-(1-Naphthylmethyl)Acetamide; N-(Naphthalen-1-Ylmethyl)Ethanamide; Acetamide, N-(1-Naphthalenylmethyl)- |
| Molecular Structure |  |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| CAS Registry Number | 19351-91-8 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)CNC(=O)C |
| InChI | 1S/C13H13NO/c1-10(15)14-9-12-7-4-6-11-5-2-3-8-13(11)12/h2-8H,9H2,1H3,(H,14,15) |
| InChIKey | SSOWOQCKTBJMET-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.915°C at 760 mmHg (Cal.) |
| Flash point | 261.33°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1-Naphthalenylmethyl)-Acetamide |