Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diallyldiethylammonium Chloride |
|---|---|
| Synonyms | Diallyl-Diethyl-Ammonium Chloride; Diallyl-Diethylammonium Chloride; Diethyldiallylammonium Chloride |
| Molecular Structure |  |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 |
| CAS Registry Number | 13107-00-1 |
| EINECS | 236-032-9 |
| SMILES | C(C=C)[N+](CC)(CC)CC=C.[Cl-] |
| InChI | 1S/C10H20N.ClH/c1-5-9-11(7-3,8-4)10-6-2;/h5-6H,1-2,7-10H2,3-4H3;1H/q+1;/p-1 |
| InChIKey | IOMDIVZAGXCCAC-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Diallyldiethylammonium Chloride |