Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (1S,2S)-3-Fluorocyclohexa-3,5-Diene-1,2-Diol |
|---|---|
| Synonyms | Zinc04262267 |
| Molecular Structure |  |
| Molecular Formula | C6H7FO2 |
| Molecular Weight | 130.12 |
| CAS Registry Number | 131101-27-4 |
| SMILES | [C@H]1(C(=CC=C[C@@H]1O)F)O |
| InChI | 1S/C6H7FO2/c7-4-2-1-3-5(8)6(4)9/h1-3,5-6,8-9H/t5-,6+/m0/s1 |
| InChIKey | JSCDWTRUIYAHIC-NTSWFWBYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.856°C at 760 mmHg (Cal.) |
| Flash point | 97.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2S)-3-Fluorocyclohexa-3,5-Diene-1,2-Diol |