|
CAS#: 69857-37-0 Product: 2,2'-(2-Fluoro-2,5-cyclohexadiene-1,4-diylidene)dimalononitrile No suppilers available for the product. |
| Name | 2,2'-(2-Fluoro-2,5-cyclohexadiene-1,4-diylidene)dimalononitrile |
|---|---|
| Synonyms | 2-Fluoro-7,7,8,8-tetracyanoquinodimethane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3FN4 |
| Molecular Weight | 222.18 |
| CAS Registry Number | 69857-37-0 |
| SMILES | F\C\1=C\C(/C=C\C/1=C(/C#N)C#N)=C(/C#N)C#N |
| InChI | 1S/C12H3FN4/c13-12-3-8(9(4-14)5-15)1-2-11(12)10(6-16)7-17/h1-3H |
| InChIKey | BXPLEMMFZOKIHP-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 131.606°C at 760 mmHg (Cal.) |
| Flash point | 33.395°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-(2-Fluoro-2,5-cyclohexadiene-1,4-diylidene)dimalononitrile |