Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Nitro-2-Thiophenecarboxylicacid |
|---|---|
| Synonyms | 4-Nitro-2-Thiophenecarboxylic Acid; 4-Nitro-2-Thenoic Acid; Nsc108994 |
| Molecular Structure |  |
| Molecular Formula | C5H3NO4S |
| Molecular Weight | 173.14 |
| CAS Registry Number | 13138-70-0 |
| SMILES | C1=C(SC=C1[N+](=O)[O-])C(=O)O |
| InChI | 1S/C5H3NO4S/c7-5(8)4-1-3(2-11-4)6(9)10/h1-2H,(H,7,8) |
| InChIKey | SZHKHACZQDMGGI-UHFFFAOYSA-N |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-2-Thiophenecarboxylicacid |