Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Nitro-3,4-thiophenediamine |
|---|---|
| Synonyms | 2-nitrothiophene-3,4-diamine; 3,4-Thiophenediamine, 2-nitro- |
| Molecular Structure |  |
| Molecular Formula | C4H5N3O2S |
| Molecular Weight | 159.17 |
| CAS Registry Number | 90069-97-9 |
| SMILES | c1c(c(c(s1)[N+](=O)[O-])N)N |
| InChI | 1S/C4H5N3O2S/c5-2-1-10-4(3(2)6)7(8)9/h1H,5-6H2 |
| InChIKey | UEZCCRAPMXUEGU-UHFFFAOYSA-N |
| Density | 1.67g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.345°C at 760 mmHg (Cal.) |
| Flash point | 244.909°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-3,4-thiophenediamine |