Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3,4-Tetrahydrophthalazine |
|---|---|
| Synonyms | Phthalazine, 1,2,3,4-Tetrahydro-, Hydrochloride; Ro 5-0994; Nsc169891 |
| Molecular Structure |  |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 |
| CAS Registry Number | 13152-89-1 |
| EINECS | 236-093-1 |
| SMILES | [H+].C1=C2C(=CC=C1)CNNC2.[Cl-] |
| InChI | 1S/C8H10N2.ClH/c1-2-4-8-6-10-9-5-7(8)3-1;/h1-4,9-10H,5-6H2;1H |
| InChIKey | DSMOOKAFQXDFFL-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydrophthalazine |