| Glentham Life Sciences | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Cysteine derivative |
|---|---|
| Name | N-(2H3)Ethanoylcysteine |
| Synonyms | N-Acetyl-d3-L-cysteine |
| Molecular Structure | ![]() |
| Molecular Formula | C5H6D3NO3S |
| Molecular Weight | 166.21 |
| CAS Registry Number | 131685-11-5 |
| SMILES | [2H]C([2H])([2H])C(=O)NC(CS)C(=O)O |
| InChI | 1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/i1D3 |
| InChIKey | PWKSKIMOESPYIA-FIBGUPNXSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.678°C at 760 mmHg (Cal.) |
| Flash point | 200.357°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2H3)Ethanoylcysteine |