Online Database of Chemicals from Around the World
|
CAS#: 65900-18-7 Product: Ethaphos No suppilers available for the product. |
| Name | Ethaphos |
|---|---|
| Synonyms | 2,4-Dichloro-1-(Ethoxy-Propylsulfanyl-Phosphoryl)Oxy-Benzene; 2,4-Dichloro-1-[Ethoxy-(Propylthio)Phosphoryl]Oxybenzene; 2,4-Dichloro-1-[Ethoxy-(Propylthio)Phosphoryl]Oxy-Benzene |
| Molecular Structure |  |
| Molecular Formula | C11H15Cl2O3PS |
| Molecular Weight | 329.18 |
| CAS Registry Number | 65900-18-7 |
| SMILES | C1=CC(=CC(=C1O[P](SCCC)(OCC)=O)Cl)Cl |
| InChI | 1S/C11H15Cl2O3PS/c1-3-7-18-17(14,15-4-2)16-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | ZGPVUVBRTCPAPZ-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.247°C at 760 mmHg (Cal.) |
| Flash point | 189.21°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethaphos |