Online Database of Chemicals from Around the World
|
CAS#: 13180-38-6 Product: Heptafluoro-Quinoline No suppilers available for the product. |
| Name | Heptafluoro-Quinoline |
|---|---|
| Synonyms | Quinoline,Heptafluoro-; Quinoline, Heptafluoro- |
| Molecular Structure |  |
| Molecular Formula | C9F7N |
| Molecular Weight | 255.09 |
| CAS Registry Number | 13180-38-6 |
| SMILES | C1(=C2C(=C(C(=C1F)F)F)N=C(F)C(=C2F)F)F |
| InChI | 1S/C9F7N/c10-2-1-3(11)7(15)9(16)17-8(1)6(14)5(13)4(2)12 |
| InChIKey | PXEKJPZSMAMHCB-UHFFFAOYSA-N |
| Density | 1.744g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.512°C at 760 mmHg (Cal.) |
| Flash point | 107.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Heptafluoro-Quinoline |