Online Database of Chemicals from Around the World
|
CAS#: 21581-82-8 Product: 1,1,2,3,4,4,4-Heptafluoro-3-(Trifluoromethyl)But-1-Ene No suppilers available for the product. |
| Name | 1,1,2,3,4,4,4-Heptafluoro-3-(Trifluoromethyl)But-1-Ene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C5F10 |
| Molecular Weight | 250.04 |
| CAS Registry Number | 21581-82-8 |
| EINECS | 244-455-5 |
| SMILES | C(C(C(F)(F)F)(C(F)(F)F)F)(=C(F)F)F |
| InChI | 1S/C5F10/c6-1(2(7)8)3(9,4(10,11)12)5(13,14)15 |
| InChIKey | CPAQQPJFMVGXBQ-UHFFFAOYSA-N |
| Density | 1.573g/cm3 (Cal.) |
|---|---|
| Boiling point | 27.625°C at 760 mmHg (Cal.) |
| Flash point | -18.873°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,3,4,4,4-Heptafluoro-3-(Trifluoromethyl)But-1-Ene |