Online Database of Chemicals from Around the World
|
CAS#: 1320-42-9 Product: Enheptin No suppilers available for the product. |
| Name | Enheptin |
|---|---|
| Synonyms | 4-Nitrothiazol-2-Amine; 4-Nitro-2-Thiazolamine; (4-Nitrothiazol-2-Yl)Amine |
| Molecular Structure |  |
| Molecular Formula | C3H3N3O2S |
| Molecular Weight | 145.14 |
| CAS Registry Number | 1320-42-9 |
| SMILES | C1=C(N=C(S1)N)[N+](=O)[O-] |
| InChI | 1S/C3H3N3O2S/c4-3-5-2(1-9-3)6(7)8/h1H,(H2,4,5) |
| InChIKey | GGWJFTHFCOPBSY-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.056°C at 760 mmHg (Cal.) |
| Flash point | 162.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Enheptin |