Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Enilospirone |
|---|---|
| Synonyms | (2R,5Rs,6R)-6-(M-Chlorophenoxy)-2-Methyl-1-Oxa-4-Azaspiro(4.5)Decan-3-One; Enilospirona [Spanish] |
| Molecular Structure |  |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 |
| CAS Registry Number | 59798-73-1 |
| EINECS | 261-932-3 |
| SMILES | C3=C(OC2C1(NC(=O)C(O1)C)CCCC2)C=CC=C3Cl |
| InChI | 1S/C15H18ClNO3/c1-10-14(18)17-15(20-10)8-3-2-7-13(15)19-12-6-4-5-11(16)9-12/h4-6,9-10,13H,2-3,7-8H2,1H3,(H,17,18) |
| InChIKey | PSHBCUHYCLAGPZ-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.89°C at 760 mmHg (Cal.) |
| Flash point | 254.915°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Enilospirone |