Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Amino-2-Naphthoyl Chloride |
|---|---|
| Synonyms | 2-(dihydroxymethyl)-2,5-dihydrofuran-2,5-diol |
| Molecular Structure |  |
| Molecular Formula | C11H8ClNO |
| Molecular Weight | 205.64 |
| CAS Registry Number | 132614-27-8 |
| SMILES | c1cc(cc2c1cc(cc2)N)C(=O)Cl |
| InChI | 1S/C11H8ClNO/c12-11(14)9-2-1-8-6-10(13)4-3-7(8)5-9/h1-6H,13H2 |
| InChIKey | OZULEYHPGANCBI-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.976°C at 760 mmHg (Cal.) |
| Flash point | 187.232°C (Cal.) |
| Refractive index | 1.696 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-2-Naphthoyl Chloride |