Online Database of Chemicals from Around the World
|
CAS#: 99102-68-8 Product: 2-Amino-6-Naphthylamide No suppilers available for the product. |
| Name | 2-Amino-6-Naphthylamide |
|---|---|
| Synonyms | 6-Amino-2-Naphthalenecarboxamide; 6-Amino-2-Naphthamide; 2-Amino-6-Naphthylamide |
| Molecular Structure |  |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 |
| CAS Registry Number | 99102-68-8 |
| SMILES | C1=C(C=CC2=C1C=CC(=C2)N)C(N)=O |
| InChI | 1S/C11H10N2O/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H2,13,14) |
| InChIKey | PXDLQIWABAXLDG-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.547°C at 760 mmHg (Cal.) |
| Flash point | 249.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-6-Naphthylamide |