Online Database of Chemicals from Around the World
|
CAS#: 13306-69-9 Product: 4-Aminofenitrothion No suppilers available for the product. |
| Name | 4-Aminofenitrothion |
|---|---|
| Synonyms | 4-Dimethoxyphosphinothioyloxy-2-Methyl-Aniline; (4-Dimethoxythiophosphoryloxy-2-Methyl-Phenyl)Amine; 4-Aminofenitrothion |
| Molecular Structure |  |
| Molecular Formula | C9H14NO3PS |
| Molecular Weight | 247.25 |
| CAS Registry Number | 13306-69-9 |
| SMILES | C1=CC(=C(C=C1O[P](=S)(OC)OC)C)N |
| InChI | 1S/C9H14NO3PS/c1-7-6-8(4-5-9(7)10)13-14(15,11-2)12-3/h4-6H,10H2,1-3H3 |
| InChIKey | MBJWTIDJKMSHDR-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.565°C at 760 mmHg (Cal.) |
| Flash point | 155.535°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Aminofenitrothion |