Online Database of Chemicals from Around the World
|
CAS#: 5869-25-0 Product: 8-Aminofluoranthene No suppilers available for the product. |
| Name | 8-Aminofluoranthene |
|---|---|
| Synonyms | 8-Fluoranthenamine; Fluoranthen-8-Ylamine; 3-12-00-03368 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C16H11N |
| Molecular Weight | 217.27 |
| CAS Registry Number | 5869-25-0 |
| SMILES | C1=CC2=C(C=C1N)C4=C3C2=CC=CC3=CC=C4 |
| InChI | 1S/C16H11N/c17-11-7-8-12-13-5-1-3-10-4-2-6-14(16(10)13)15(12)9-11/h1-9H,17H2 |
| InChIKey | SMSRNTQALUJAHQ-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.668°C at 760 mmHg (Cal.) |
| Flash point | 250.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Aminofluoranthene |