Online Database of Chemicals from Around the World
|
CAS#: 1331-47-1 Product: Dichloro-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride No suppilers available for the product. |
| Name | Dichloro-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride |
|---|---|
| Synonyms | 4-(4-Aminophenyl)-2,3-Dichloro-Aniline; [4-(4-Aminophenyl)-2,3-Dichloro-Phenyl]Amine; Dichlorobenzidine |
| Molecular Structure |  |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 |
| CAS Registry Number | 1331-47-1 |
| SMILES | C1=C(C(=C(Cl)C(=C1)N)Cl)C2=CC=C(N)C=C2 |
| InChI | 1S/C12H10Cl2N2/c13-11-9(5-6-10(16)12(11)14)7-1-3-8(15)4-2-7/h1-6H,15-16H2 |
| InChIKey | LPDSNGAFAJYVKH-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.727°C at 760 mmHg (Cal.) |
| Flash point | 188.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro-(1,1'-Biphenyl)-4,4'-Diamine Dihydrochloride |