Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,3'-Dichlorobiphenyl 4,4'-Diisocyanate |
|---|---|
| Synonyms | 2-Chloro-4-(3-Chloro-4-Isocyanato-Phenyl)-1-Isocyanato-Benzene; 3,3'-Dichloro-4,4'-Isocyanatobiphenyl; Nsc2338 |
| Molecular Structure |  |
| Molecular Formula | C14H6Cl2N2O2 |
| Molecular Weight | 305.12 |
| CAS Registry Number | 5331-87-3 |
| SMILES | O=C=NC2=C(C=C(C1=CC(=C(N=C=O)C=C1)Cl)C=C2)Cl |
| InChI | 1S/C14H6Cl2N2O2/c15-11-5-9(1-3-13(11)17-7-19)10-2-4-14(18-8-20)12(16)6-10/h1-6H |
| InChIKey | JITXMLLVGWGFGV-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Melting point | 168°C (Expl.) |
| Boiling point | 407.322°C at 760 mmHg (Cal.) |
| Flash point | 150.743°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,3'-Dichlorobiphenyl 4,4'-Diisocyanate |