Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-(Chloromethyl)-5-[2-(Trifluoromethyl)Phenyl]-1,2,4-Oxadiazole |
|---|---|
| Synonyms | 3-(Chloro |
| Molecular Structure | ![CAS#: 133144-89-5， 3-(Chloromethyl)-5-[2-(Trifluoromethyl)Phenyl]-1,2,4-Oxadiazole](/moreStructures/133144-89-5.gif) |
| Molecular Formula | C10H6ClF3N2O |
| Molecular Weight | 262.62 |
| CAS Registry Number | 133144-89-5 |
| SMILES | ClCc1nc(on1)c2ccccc2C(F)(F)F |
| InChI | 1S/C10H6ClF3N2O/c11-5-8-15-9(17-16-8)6-3-1-2-4-7(6)10(12,13)14/h1-4H,5H2 |
| InChIKey | GIQDUNZXUKYGEP-UHFFFAOYSA-N |
| Density | 1.418g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.822°C at 760 mmHg (Cal.) |
| Flash point | 152.062°C (Cal.) |
| Refractive index | 1.495 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Chloromethyl)-5-[2-(Trifluoromethyl)Phenyl]-1,2,4-Oxadiazole |