|
CAS#: 499785-53-4 Product: 2-(Chloromethyl)-4-[4-(Trifluoromethyl)Phenyl]-1,3-Thiazole No suppilers available for the product. |
| Name | 2-(Chloromethyl)-4-[4-(Trifluoromethyl)Phenyl]-1,3-Thiazole |
|---|---|
| Synonyms | 2-(Chloromethyl)-4-(4-(trifluoromethyl)phenyl)-1,3-thiazole; ZINC00163147 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7ClF3NS |
| Molecular Weight | 277.69 |
| CAS Registry Number | 499785-53-4 |
| SMILES | ClCc2nc(c1ccc(cc1)C(F)(F)F)cs2 |
| InChI | 1S/C11H7ClF3NS/c12-5-10-16-9(6-17-10)7-1-3-8(4-2-7)11(13,14)15/h1-4,6H,5H2 |
| InChIKey | NSHFNNYKHBYRDL-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.081°C at 760 mmHg (Cal.) |
| Flash point | 147.38°C (Cal.) |
| Refractive index | 1.537 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloromethyl)-4-[4-(Trifluoromethyl)Phenyl]-1,3-Thiazole |