|
CAS#: 133386-21-7 Product: Triphosphoric Acid, Mono[[(2S,3R,4R)-4-(2-Amino-3,6-Dihydro-6-Oxo-9H-Purin-9-Yl)-3-(Hydroxymethyl)-2-Oxetanyl]Methyl] Ester No suppilers available for the product. |
| Name | Triphosphoric Acid, Mono[[(2S,3R,4R)-4-(2-Amino-3,6-Dihydro-6-Oxo-9H-Purin-9-Yl)-3-(Hydroxymethyl)-2-Oxetanyl]Methyl] Ester |
|---|---|
| Synonyms | Oxetanocin G triphosphate; Oxt-GTP; AIDS004295 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N5O13P3 |
| Molecular Weight | 507.18 |
| CAS Registry Number | 133386-21-7 |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1C(=O)\N=C(\N)Nc12)[C@@H]3CO |
| InChI | 1S/C10H16N5O13P3/c11-10-13-7-6(8(17)14-10)12-3-15(7)9-4(1-16)5(26-9)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-5,9,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5-,9-/m1/s1 |
| InChIKey | ZTQGKUZQXQHVIV-UDJQAZALSA-N |
| Density | 2.636g/cm3 (Cal.) |
|---|---|
| Boiling point | 968.366°C at 760 mmHg (Cal.) |
| Flash point | 539.448°C (Cal.) |
| Refractive index | 1.904 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triphosphoric Acid, Mono[[(2S,3R,4R)-4-(2-Amino-3,6-Dihydro-6-Oxo-9H-Purin-9-Yl)-3-(Hydroxymethyl)-2-Oxetanyl]Methyl] Ester |