| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Organometallic compound >> Organic palladium |
|---|---|
| Name | Chloro(crotyl)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H35ClNPPd |
| Molecular Weight | 462.35 |
| CAS Registry Number | 1334497-06-1 |
| SMILES | C/C=C/[CH2-].CC(C)(C)P(C1=CC=C(C=C1)N(C)C)C(C)(C)C.Cl[Pd+] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
|
Chloro(crotyl)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II) is a specialized palladium complex that has garnered attention for its role in catalysis. This compound features a palladium center coordinated with a chloro ligand, a crotyl group, and a unique phosphine ligand, di-tert-butyl(4-dimethylaminophenyl)phosphine. The combination of these components imparts distinctive properties to the complex, making it useful in various chemical reactions. The discovery of Chloro(crotyl)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II) is part of ongoing research in organometallic chemistry, particularly in the development of effective catalysts. Palladium complexes are well-known for their utility in facilitating a range of organic transformations due to their ability to engage in various oxidation states and coordination environments. The crotyl group in this complex introduces an allylic functionality that can be involved in numerous reactions, while the phosphine ligand enhances the stability and reactivity of the palladium center. In terms of applications, this palladium complex is valuable in catalyzing cross-coupling reactions, which are fundamental in organic synthesis. Cross-coupling reactions, such as the Heck reaction, Suzuki coupling, and Negishi coupling, are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the crotyl group provides additional versatility in these reactions, allowing for the creation of various substituted products. The di-tert-butyl(4-dimethylaminophenyl)phosphine ligand plays a crucial role in stabilizing the palladium center and modulating its reactivity. The bulky tert-butyl groups help prevent catalyst deactivation and promote high selectivity, while the 4-dimethylaminophenyl group enhances electronic interactions with the palladium center. This combination of steric and electronic effects makes the catalyst efficient in various coupling reactions. Additionally, Chloro(crotyl)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II) finds applications in materials science and the development of new chemical processes. Its ability to catalyze reactions that produce complex organic molecules makes it a valuable tool in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. The versatility of the crotyl group allows for the introduction of various functional groups, expanding the range of possible reactions and products. In summary, Chloro(crotyl)[di-tert-butyl(4-dimethylaminophenyl)phosphine]palladium(II) is an important palladium complex in catalysis, offering unique properties for cross-coupling reactions and organic synthesis. Its innovative ligand design enhances the stability and reactivity of the palladium center, making it a valuable asset in the development of complex molecules and materials. |
| Market Analysis Reports |