Online Database of Chemicals from Around the World
|
CAS#: 1335-85-9 Product: Dinitro-O-Cresol No suppilers available for the product. |
| Name | Dinitro-O-Cresol |
|---|---|
| Synonyms | 2-Methyl-3,4-Dinitro-Phenol; 2-Methyldinitrophenol; Dinitro-O-Cresols |
| Molecular Structure |  |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 |
| CAS Registry Number | 1335-85-9 |
| SMILES | C1=CC(=C([N+]([O-])=O)C(=C1O)C)[N+]([O-])=O |
| InChI | 1S/C7H6N2O5/c1-4-6(10)3-2-5(8(11)12)7(4)9(13)14/h2-3,10H,1H3 |
| InChIKey | IUOFDOCUNLJHFO-UHFFFAOYSA-N |
| Density | 1.55g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.717°C at 760 mmHg (Cal.) |
| 312.2222°C (Expl.) | |
| Flash point | 186.725°C (Cal.) |
| solubility | 0.01% |
| Market Analysis Reports |
| List of Reports Available for Dinitro-O-Cresol |