| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1,4-Dinitrobutane |
|---|---|
| Synonyms | Butane, 1,4-Dinitro-; Nsc405667 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 |
| CAS Registry Number | 4286-49-1 |
| SMILES | C([N+](=O)[O-])CCC[N+](=O)[O-] |
| InChI | 1S/C4H8N2O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2 |
| InChIKey | KWFGJLCFMKVZLQ-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.958°C at 760 mmHg (Cal.) |
| Flash point | 130.427°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4-Dinitrobutane |