Online Database of Chemicals from Around the World

Methyl 3-bromo-6-chloropyrazine-2-carboxylate
[CAS# 13457-28-8]

List of Suppliers
Xi'an Tuochao Biotechnology Co., Ltd. China Inquire
www.xatuochao.cn
+86 18092957403
chen.zeshan@xatuochao.com
QQ Chat
Skype Chat
WeChat: +8618092957403
WhatsApp:+8618092957403
Chemical manufacturer since 2017
chemBlink Standard supplier since 2023

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
NameMethyl 3-bromo-6-chloropyrazine-2-carboxylate
Molecular StructureCAS # 13457-28-8, Methyl 3-bromo-6-chloropyrazine-2-carboxylate
Molecular FormulaC6H4BrClN2O2
Molecular Weight251.47
CAS Registry Number13457-28-8
SMILESCOC(=O)C1=NC(=CN=C1Br)Cl
Properties
Density1.8±0.1 g/cm3, Calc.*
Melting point35-36 °C
Index of Refraction1.574, Calc.*
Boiling Point292.4±35.0 °C (760 mmHg), Calc.*
Flash Point130.6±25.9 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302  Details
Safety StatementsP280-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
Methyl 3-bromo-6-chloropyrazine-2-carboxylate is an important chemical compound within the field of medicinal chemistry and agrochemicals, known for its diverse applications in synthesis and research. Its molecular formula is C8H6BrClN2O2, and it features both halogen atoms and a carboxylate group, which contributes to its reactivity and utility in various chemical transformations.

The discovery of methyl 3-bromo-6-chloropyrazine-2-carboxylate can be traced back to research focused on the synthesis of pyrazine derivatives, which are recognized for their biological activity and structural complexity. Pyrazine and its derivatives have been investigated for their potential as pharmaceutical agents, fungicides, and herbicides. The introduction of halogen substituents, such as bromine and chlorine, in the pyrazine ring enhances its reactivity and allows for further functionalization, making it a valuable building block in organic synthesis.

One of the notable applications of methyl 3-bromo-6-chloropyrazine-2-carboxylate lies in the synthesis of biologically active compounds. The presence of the bromine and chlorine atoms facilitates cross-coupling reactions, such as Suzuki and Sonogashira reactions, which are widely used to construct complex organic molecules. Additionally, the compound has been explored for its potential use in the development of new agrochemicals, particularly in designing novel herbicides and fungicides that can target specific plant pathogens.

Research has demonstrated that modifications of the pyrazine ring can lead to compounds with significant pharmacological properties. For instance, derivatives of methyl 3-bromo-6-chloropyrazine-2-carboxylate have been synthesized and evaluated for their activity against various cancer cell lines, showcasing the potential of such compounds in medicinal chemistry. Furthermore, the compound serves as an intermediate in the synthesis of more complex molecules, allowing researchers to explore structure-activity relationships and optimize compounds for specific biological activities.

In summary, methyl 3-bromo-6-chloropyrazine-2-carboxylate is a significant compound in organic synthesis and drug development, with applications in both medicinal chemistry and agrochemicals. Its unique structure, featuring halogen substituents, provides a versatile platform for further chemical modifications and research into novel therapeutic agents.

References

none
Market Analysis Reports
List of Reports Available for Methyl 3-bromo-6-chloropyrazine-2-carboxylate
Related Products
Methyl 8-broMo-...  Methyl 5-bromo-...  Methyl 4-bromo-...  Methyl 3-bromo-...  Methyl 5-broMo-...  Methyl 6-bromo-...  Methyl 5-bromo-...  Methyl N-[4-[(2...  Methyl (2R)-2-b...  Methyl alpha-br...  Methyl 5-bromo-...  Methyl 5-bromo-...  Methyl 8-bromo-...  Methyl 8-bromo-...  Methyl 6-bromo-...  Methyl 3-bromoc...  Methyl 4-bromoc...  (E)-Methyl 4-br...  Methyl 3-bromo-...  Methyl 3-(5-bro...