Online Database of Chemicals from Around the World
|
CAS#: 13461-01-3 Product: Aceprometazine No suppilers available for the product. |
| Name | Aceprometazine |
|---|---|
| Synonyms | 1-[10-(2-Dimethylaminopropyl)-2-Phenothiazinyl]Ethanone; 10-(2-(Dimethylamino)Propyl)Phenothiazin-2-Yl Methyl Ketone; 1664 Cb |
| Molecular Structure |  |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 |
| CAS Registry Number | 13461-01-3 |
| EINECS | 236-661-9 |
| SMILES | C1=CC2=C(C=C1)SC3=C(N2CC(C)N(C)C)C=C(C=C3)C(=O)C |
| InChI | 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 |
| InChIKey | XLOQNFNTQIRSOX-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.123°C at 760 mmHg (Cal.) |
| Flash point | 250.218°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aceprometazine |