Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2-Bis(2-Chlorophenyl)-Diazene 1-Oxide |
|---|---|
| Synonyms | (2-Chlorophenyl)-(2-Chlorophenyl)Imino-Oxido-Ammonium; (2-Chlorophenyl)-(2-Chlorophenyl)Imino-Oxidoammonium; (2-Chlorophenyl)-(2-Chlorophenyl)Imino-Oxido-Azanium |
| Molecular Structure |  |
| Molecular Formula | C12H8Cl2N2O |
| Molecular Weight | 267.11 |
| CAS Registry Number | 13556-84-8 |
| EINECS | 236-941-0 |
| SMILES | C1=CC=CC(=C1[N-][N+](C2=CC=CC=C2Cl)=O)Cl |
| InChI | 1S/C12H8Cl2N2O/c13-9-5-1-3-7-11(9)15-16(17)12-8-4-2-6-10(12)14/h1-8H |
| InChIKey | NKUNBLUACJUHOA-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.734°C at 760 mmHg (Cal.) |
| Flash point | 201.6°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(2-Chlorophenyl)-Diazene 1-Oxide |