Online Database of Chemicals from Around the World
|
CAS#: 7457-25-2 Product: Bis(4-Chlorophenyl)Dichloromethane No suppilers available for the product. |
| Name | Bis(4-Chlorophenyl)Dichloromethane |
|---|---|
| Synonyms | 4-05-00-01850 (Beilstein Handbook Reference); Brn 2561039; Bis(P-Chlorophenyl)Dichloromethane |
| Molecular Structure |  |
| Molecular Formula | C13H8Cl4 |
| Molecular Weight | 306.02 |
| CAS Registry Number | 7457-25-2 |
| SMILES | C2=C(C(Cl)(Cl)C1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C13H8Cl4/c14-11-5-1-9(2-6-11)13(16,17)10-3-7-12(15)8-4-10/h1-8H |
| InChIKey | CYRZYVXEHUQRAE-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.649°C at 760 mmHg (Cal.) |
| Flash point | 183.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Chlorophenyl)Dichloromethane |