|
CAS#: 13589-07-6 Product: (2S)-2-{[(2S)-2-Ammonio-3-Methylbutanoyl]Amino}-3-(1H-Imidazol-5-Yl)Propanoate No suppilers available for the product. |
| Name | (2S)-2-{[(2S)-2-Ammonio-3-Methylbutanoyl]Amino}-3-(1H-Imidazol-5-Yl)Propanoate |
|---|---|
| Synonyms | H-VAL-HIS-OH; L-Val-L-His; L-valyl-L-histidine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 |
| CAS Registry Number | 13589-07-6 |
| SMILES | [O-]C(=O)[C@@H](NC(=O)[C@@H]([NH3+])C(C)C)Cc1cncn1 |
| InChI | 1S/C11H18N4O3/c1-6(2)9(12)10(16)15-8(11(17)18)3-7-4-13-5-14-7/h4-6,8-9H,3,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 |
| InChIKey | BNQVUHQWZGTIBX-IUCAKERBSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.427°C at 760 mmHg (Cal.) |
| Flash point | 319.951°C (Cal.) |
| Refractive index | 1.566 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-{[(2S)-2-Ammonio-3-Methylbutanoyl]Amino}-3-(1H-Imidazol-5-Yl)Propanoate |