| Eburon Organics bvba | Belgium | Inquire | ||
|---|---|---|---|---|
![]() |
+32 (51) 335-068 | |||
![]() |
sales@eburon-organics.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Phenylalanine derivatives |
|---|---|
| Name | (2S)-2-(9H-Fluoren-9-Ylmethoxycarbonylamino)-3-(2-Methylphenyl)Propanoate |
| Synonyms | (2S)-2-[(9H-Fluoren-9-Ylmethoxy-Oxomethyl)Amino]-3-(2-Methylphenyl)Propanoate; (2S)-2-(9H-Fluoren-9-Ylmethoxycarbonylamino)-3-(2-Methylphenyl)Propionate; Zinc04208800 |
| Molecular Structure | ![]() |
| Molecular Formula | C25H22NO4 |
| Molecular Weight | 400.45 |
| CAS Registry Number | 135944-06-8 |
| SMILES | [C@H](NC(OCC2C1=CC=CC=C1C3=CC=CC=C23)=O)(CC4=CC=CC=C4C)C([O-])=O |
| InChI | 1S/C25H23NO4/c1-16-8-2-3-9-17(16)14-23(24(27)28)26-25(29)30-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/p-1/t23-/m0/s1 |
| InChIKey | GYFMRMRGTNDDAT-QHCPKHFHSA-M |
| Boiling point | 631.05°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 335.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(9H-Fluoren-9-Ylmethoxycarbonylamino)-3-(2-Methylphenyl)Propanoate |