| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> FMOC-amino acid |
|---|---|
| Name | (3R)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}-3-(2-Methylphenyl)Propanoic Acid |
| Synonyms | (R)-3-((( |
| Molecular Structure | ![]() |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.45 |
| CAS Registry Number | 507472-27-7 |
| SMILES | O=C(O)C[C@H](c1ccccc1C)NC(=O)OCC4c2ccccc2c3c4cccc3 |
| InChI | 1S/C25H23NO4/c1-16-8-2-3-9-17(16)23(14-24(27)28)26-25(29)30-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m1/s1 |
| InChIKey | WLJJHZZZEHMKOE-HSZRJFAPSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.088°C at 760 mmHg (Cal.) |
| Flash point | 333.656°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-{[(9H-Fluoren-9-Ylmethoxy)Carbonyl]Amino}-3-(2-Methylphenyl)Propanoic Acid |