| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | Bis(pentafluorophenyl)phosphinous bromide |
|---|---|
| Synonyms | Bis(pentafluorophenyl)bromophosphine; Bis(perfluorophenyl)bromophosphine; Bromo-bis(pentafluorophenyl)phosphine |
| Molecular Structure | ![]() |
| Molecular Formula | C12BrF10P |
| Molecular Weight | 444.99 |
| CAS Registry Number | 13648-79-8 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)P(Br)c2c(F)c(F)c(F)c(F)c2F |
| InChI | 1S/C12BrF10P/c13-24(11-7(20)3(16)1(14)4(17)8(11)21)12-9(22)5(18)2(15)6(19)10(12)23 |
| InChIKey | WDFHFZAPZSABGO-UHFFFAOYSA-N |
| Boiling point | 346.1028°C (Expl.) |
|---|---|
| 309.257°C at 760 mmHg (Cal.) | |
| Flash point | 140.834°C (Cal.) |
| Refractive index | (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bis(pentafluorophenyl)phosphinous bromide |