Online Database of Chemicals from Around the World
|
CAS#: 20901-24-0 Product: Bis(Pentafluorophenyl)(Phenyl)Arsine No suppilers available for the product. |
| Name | Bis(Pentafluorophenyl)(Phenyl)Arsine |
|---|---|
| Synonyms | Bis(2,3,4,5,6-pentafluorophenyl)(phenyl)arsine # |
| Molecular Structure |  |
| Molecular Formula | C18H5AsF10 |
| Molecular Weight | 486.14 |
| CAS Registry Number | 20901-24-0 |
| SMILES | Fc1c(c(F)c(F)c(F)c1F)[As](c2ccccc2)c3c(F)c(F)c(F)c(F)c3F |
| InChI | 1S/C18H5AsF10/c20-9-7(10(21)14(25)17(28)13(9)24)19(6-4-2-1-3-5-6)8-11(22)15(26)18(29)16(27)12(8)23/h1-5H |
| InChIKey | GDLLDXXSHOPIAJ-UHFFFAOYSA-N |
| Boiling point | 360.52°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 138.02°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Pentafluorophenyl)(Phenyl)Arsine |