Online Database of Chemicals from Around the World
|
CAS#: 136944-22-4 Product: (2Z)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxyphenyl)Acrylamide No suppilers available for the product. |
| Name | (2Z)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxyphenyl)Acrylamide |
|---|---|
| Synonyms | 2-PROPENAMIDE, 3-(3,4-DIHYDROXYPHENYL)-N-(3,4-DI |
| Molecular Structure |  |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.32 |
| CAS Registry Number | 136944-22-4 |
| SMILES | COc1cc(ccc1OC)NC(=O)\C=C/c2ccc(O)c(O)c2 |
| InChI | 1S/C17H17NO5/c1-22-15-7-5-12(10-16(15)23-2)18-17(21)8-4-11-3-6-13(19)14(20)9-11/h3-10,19-20H,1-2H3,(H,18,21)/b8-4- |
| InChIKey | DEOHUSDXNWMAHF-YWEYNIOJSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.036°C at 760 mmHg (Cal.) |
| Flash point | 300.966°C (Cal.) |
| Refractive index | 1.672 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxyphenyl)Acrylamide |