Online Database of Chemicals from Around the World
|
CAS#: 136944-23-5 Product: (2E)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxybenzyl)Acrylamide No suppilers available for the product. |
| Name | (2E)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxybenzyl)Acrylamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 |
| CAS Registry Number | 136944-23-5 |
| SMILES | COc1cc(ccc1OC)CNC(=O)/C=C/c2ccc(O)c(O)c2 |
| InChI | 1S/C18H19NO5/c1-23-16-7-4-13(10-17(16)24-2)11-19-18(22)8-5-12-3-6-14(20)15(21)9-12/h3-10,20-21H,11H2,1-2H3,(H,19,22)/b8-5+ |
| InChIKey | AUVWQXWYHSOBAW-VMPITWQZSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 609.375°C at 760 mmHg (Cal.) |
| Flash point | 322.338°C (Cal.) |
| Refractive index | 1.631 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-(3,4-Dihydroxyphenyl)-N-(3,4-Dimethoxybenzyl)Acrylamide |